C9H7N3S — CID 21486269
3-amino-4-methyl-2,1-benzothiazole-6-carbonitrile (PubChem CID 21486269) has the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-amino-4-methyl-2,1-benzothiazole-6-carbonitrile.
| Compound Name | 3-amino-4-methyl-2,1-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 21486269 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3-amino-4-methyl-2,1-benzothiazole-6-carbonitrile |
| SMILES | Cc1cc(C#N)cc2nsc(N)c12 |
| InChI | InChI=1S/C9H7N3S/c1-5-2-6(4-10)3-7-8(5)9(11)13-12-7/h2-3H,11H2,1H3 |
| InChIKey | RIFFXIBYFUYSPM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |