C27H33Cl2N3O4 — CID 67377291
(2'R,4'S)-6-chloro-2'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide (PubChem CID 67377291) has the molecular formula C27H33Cl2N3O4 and a molecular weight of 534.48 g/mol. Its IUPAC name is (2'R,4'S)-6-chloro-2'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | (2'R,4'S)-6-chloro-2'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 67377291 |
| Molecular Formula | C27H33Cl2N3O4 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (2'R,4'S)-6-chloro-2'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1CN(C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2)C12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H33Cl2N3O4/c1-26(2,3)13-17-14-32(25(36)30-10-9-20(34)15-33)23(16-5-4-6-18(28)11-16)27(17)21-8-7-19(29)12-22(21)31-24(27)35/h4-8,11-12,17,20,23,33-34H,9-10,13-15H2,1-3H3,(H,30,36)(H,31,35)/t17-,20+,23-,27?/m1/s1 |
| InChIKey | WUYDZXMXAOZDMI-XPWUNNDJSA-N |
| XLogP | 4.75 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |