C27H32Cl2FN3O4 — CID 67377208
(2'R,3S,4'R)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide (PubChem CID 67377208) has the molecular formula C27H32Cl2FN3O4 and a molecular weight of 552.47 g/mol. Its IUPAC name is (2'R,3S,4'R)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide.
| Compound Name | (2'R,3S,4'R)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide |
|---|---|
| PubChem CID | 67377208 |
| Molecular Formula | C27H32Cl2FN3O4 |
| Molecular Weight | 552.47 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | (2'R,3S,4'R)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(2,2-dimethylpropyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide |
| SMILES | CC(C)(C)C[C@H]1CN[C@@H](c2cccc(Cl)c2F)[C@]12C(=O)N(C(=O)NCC[C@H](O)CO)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C27H32Cl2FN3O4/c1-26(2,3)12-15-13-32-23(18-5-4-6-20(29)22(18)30)27(15)19-8-7-16(28)11-21(19)33(24(27)36)25(37)31-10-9-17(35)14-34/h4-8,11,15,17,23,32,34-35H,9-10,12-14H2,1-3H3,(H,31,37)/t15-,17-,23-,27-/m0/s1 |
| InChIKey | MUDCVKZVINFWQR-XPUXDFMESA-N |
| XLogP | 4.57 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |