C28H34Cl2FN3O5 — CID 67375844
(2'S,3R,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide (PubChem CID 67375844) has the molecular formula C28H34Cl2FN3O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is (2'S,3R,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide.
| Compound Name | (2'S,3R,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide |
|---|---|
| PubChem CID | 67375844 |
| Molecular Formula | C28H34Cl2FN3O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2'S,3R,4'S)-6-chloro-2'-(3-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-4'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[indole-3,3'-pyrrolidine]-1-carboxamide |
| SMILES | CC(C)(CCO)C[C@@H]1CN[C@H](c2cccc(Cl)c2F)[C@@]12C(=O)N(C(=O)NCC[C@H](O)CO)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H34Cl2FN3O5/c1-27(2,9-11-35)13-16-14-33-24(19-4-3-5-21(30)23(19)31)28(16)20-7-6-17(29)12-22(20)34(25(28)38)26(39)32-10-8-18(37)15-36/h3-7,12,16,18,24,33,35-37H,8-11,13-15H2,1-2H3,(H,32,39)/t16-,18+,24-,28-/m1/s1 |
| InChIKey | URUGAQAQNBKYLK-RDMQKDHFSA-N |
| XLogP | 3.93 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |