C19H23N3O3 — CID 67377677
5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylic acid (PubChem CID 67377677) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylic acid.
| Compound Name | 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 67377677 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cn1Cc1cccc(C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-14-10-17(19(24)25)13-22(14)12-15-4-3-5-16(11-15)18(23)21-8-6-20(2)7-9-21/h3-5,10-11,13H,6-9,12H2,1-2H3,(H,24,25) |
| InChIKey | OSDDDXAKVABMFT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |