C20H25N3O3 — CID 70890130
methyl 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylate (PubChem CID 70890130) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylate.
| Compound Name | methyl 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 70890130 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | methyl 5-methyl-1-[[3-(4-methylpiperazine-1-carbonyl)phenyl]methyl]pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(C)n(Cc2cccc(C(=O)N3CCN(C)CC3)c2)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-15-11-18(20(25)26-3)14-23(15)13-16-5-4-6-17(12-16)19(24)22-9-7-21(2)8-10-22/h4-6,11-12,14H,7-10,13H2,1-3H3 |
| InChIKey | AIQLNAGWFMFEHJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |