C24H20N6O5 — CID 67377838
3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]phenyl]methyl]triazole-4-carboxamide (PubChem CID 67377838) has the molecular formula C24H20N6O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 67377838 |
| Molecular Formula | C24H20N6O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 3-[[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindole-4-carbonyl]phenyl]methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cnnn1Cc1ccc(C(=O)c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H20N6O5/c25-22(33)19-10-26-28-30(19)11-13-4-6-14(7-5-13)21(32)15-2-1-3-16-17(15)12-29(24(16)35)18-8-9-20(31)27-23(18)34/h1-7,10,18H,8-9,11-12H2,(H2,25,33)(H,27,31,34) |
| InChIKey | HCCORJPIFXORIN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 157.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|