C23H18N4O2S2 — CID 6737895
4,5-dimethyl-12-phenacylsulfanyl-8-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one (PubChem CID 6737895) has the molecular formula C23H18N4O2S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 4,5-dimethyl-12-phenacylsulfanyl-8-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one.
| Compound Name | 4,5-dimethyl-12-phenacylsulfanyl-8-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 6737895 |
| Molecular Formula | C23H18N4O2S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4,5-dimethyl-12-phenacylsulfanyl-8-phenyl-3-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
| SMILES | Cc1sc2c(c1C)c(=O)n(-c1ccccc1)c1nnc(SCC(=O)c3ccccc3)n21 |
| InChI | InChI=1S/C23H18N4O2S2/c1-14-15(2)31-21-19(14)20(29)26(17-11-7-4-8-12-17)22-24-25-23(27(21)22)30-13-18(28)16-9-5-3-6-10-16/h3-12H,13H2,1-2H3 |
| InChIKey | HPGPLBFBBJALJD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |