C16H20N2O4 — CID 67379737
2-(1,2-dihydroquinolin-8-yloxy)-2-(pentanoylamino)acetic acid (PubChem CID 67379737) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(1,2-dihydroquinolin-8-yloxy)-2-(pentanoylamino)acetic acid.
| Compound Name | 2-(1,2-dihydroquinolin-8-yloxy)-2-(pentanoylamino)acetic acid |
|---|---|
| PubChem CID | 67379737 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(1,2-dihydroquinolin-8-yloxy)-2-(pentanoylamino)acetic acid |
| SMILES | CCCCC(=O)NC(Oc1cccc2c1NCC=C2)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-2-3-9-13(19)18-15(16(20)21)22-12-8-4-6-11-7-5-10-17-14(11)12/h4-8,15,17H,2-3,9-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | PCOKUHKRFUMNJL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|