C30H28F3N3O8S — CID 67380411
6-[1-[2-(difluoromethoxy)-4-fluorophenyl]-5-methyl-4-[(4-methylsulfonylphenyl)carbamoyl]pyrrol-2-yl]-4-nitro-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67380411) has the molecular formula C30H28F3N3O8S and a molecular weight of 647.63 g/mol. Its IUPAC name is 6-[1-[2-(difluoromethoxy)-4-fluorophenyl]-5-methyl-4-[(4-methylsulfonylphenyl)carbamoyl]pyrrol-2-yl]-4-nitro-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-[1-[2-(difluoromethoxy)-4-fluorophenyl]-5-methyl-4-[(4-methylsulfonylphenyl)carbamoyl]pyrrol-2-yl]-4-nitro-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 67380411 |
| Molecular Formula | C30H28F3N3O8S |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | 6-[1-[2-(difluoromethoxy)-4-fluorophenyl]-5-methyl-4-[(4-methylsulfonylphenyl)carbamoyl]pyrrol-2-yl]-4-nitro-1-propan-2-ylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cc(C2C=C([N+](=O)[O-])C=CC2(C(=O)O)C(C)C)n1-c1ccc(F)cc1OC(F)F |
| InChI | InChI=1S/C30H28F3N3O8S/c1-16(2)30(28(38)39)12-11-20(36(40)41)14-23(30)25-15-22(27(37)34-19-6-8-21(9-7-19)45(4,42)43)17(3)35(25)24-10-5-18(31)13-26(24)44-29(32)33/h5-16,23,29H,1-4H3,(H,34,37)(H,38,39) |
| InChIKey | XTFUEMZDEIAPPJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|