About 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine
7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine (PubChem CID 67380437) has the molecular formula C14H32N4
and a molecular weight of 256.44 g/mol. Its IUPAC name is 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine.
Molecular Properties
| Compound Name | 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine |
| PubChem CID | 67380437 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine |
| SMILES | CNCCC(N)CCCCNC1CCCC(N)C1 |
| InChI | InChI=1S/C14H32N4/c1-17-10-8-12(15)5-2-3-9-18-14-7-4-6-13(16)11-14/h12-14,17-18H,2-11,15-16H2,1H3 |
| InChIKey | CUTHRAYWCIHRAR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine?
The IUPAC name of 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine (CID 67380437) is 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine.
What is the SMILES notation for 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine?
The canonical SMILES for 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine is CNCCC(N)CCCCNC1CCCC(N)C1.
What is the InChIKey of 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine?
The InChIKey is CUTHRAYWCIHRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N4/c1-17-10-8-12(15)5-2-3-9-18-14-7-4-6-13(16)11-14/h12-14,17-18H,2-11,15-16H2,1H3.
What are the key properties of 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine?
7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine has a molecular weight of 256.44 g/mol, XLogP of 0.95, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-N-(3-aminocyclohexyl)-1-N-methylheptane-1,3,7-triamine is sourced from PubChem (CID 67380437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).