C25H22F3N5O2 — CID 67382987
(6S)-3'-(4,4-difluoropiperidin-1-yl)-7'-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1,4-oxazine-6,5'-chromeno[2,3-c]pyridine]-2-amine (PubChem CID 67382987) has the molecular formula C25H22F3N5O2 and a molecular weight of 481.48 g/mol. Its IUPAC name is (6S)-3'-(4,4-difluoropiperidin-1-yl)-7'-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1,4-oxazine-6,5'-chromeno[2,3-c]pyridine]-2-amine.
| Compound Name | (6S)-3'-(4,4-difluoropiperidin-1-yl)-7'-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1,4-oxazine-6,5'-chromeno[2,3-c]pyridine]-2-amine |
|---|---|
| PubChem CID | 67382987 |
| Molecular Formula | C25H22F3N5O2 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (6S)-3'-(4,4-difluoropiperidin-1-yl)-7'-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1,4-oxazine-6,5'-chromeno[2,3-c]pyridine]-2-amine |
| SMILES | NC1CN=C[C@]2(O1)c1cc(-c3cccnc3F)ccc1Oc1cnc(N3CCC(F)(F)CC3)cc12 |
| InChI | InChI=1S/C25H22F3N5O2/c26-23-16(2-1-7-31-23)15-3-4-19-17(10-15)25(14-30-13-21(29)35-25)18-11-22(32-12-20(18)34-19)33-8-5-24(27,28)6-9-33/h1-4,7,10-12,14,21H,5-6,8-9,13,29H2/t21?,25-/m0/s1 |
| InChIKey | NMDYMWVYJJAMAB-QBGQUKIHSA-N |
| XLogP | 4.25 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|