C26H20F2N4O2 — CID 67382799
(2R)-2'-(2-fluoro-3-pyridinyl)-7'-(2-fluoro-4-pyridinyl)spiro[morpholine-6,9'-xanthene]-2-amine (PubChem CID 67382799) has the molecular formula C26H20F2N4O2 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2R)-2'-(2-fluoro-3-pyridinyl)-7'-(2-fluoro-4-pyridinyl)spiro[morpholine-6,9'-xanthene]-2-amine.
| Compound Name | (2R)-2'-(2-fluoro-3-pyridinyl)-7'-(2-fluoro-4-pyridinyl)spiro[morpholine-6,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 67382799 |
| Molecular Formula | C26H20F2N4O2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (2R)-2'-(2-fluoro-3-pyridinyl)-7'-(2-fluoro-4-pyridinyl)spiro[morpholine-6,9'-xanthene]-2-amine |
| SMILES | N[C@H]1CNCC2(O1)c1cc(-c3ccnc(F)c3)ccc1Oc1ccc(-c3cccnc3F)cc12 |
| InChI | InChI=1S/C26H20F2N4O2/c27-23-12-16(7-9-31-23)15-3-5-21-19(10-15)26(14-30-13-24(29)34-26)20-11-17(4-6-22(20)33-21)18-2-1-8-32-25(18)28/h1-12,24,30H,13-14,29H2/t24-,26?/m1/s1 |
| InChIKey | VFZOZEPZFOGTPU-RMVMEJTISA-N |
| XLogP | 4.34 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|