C25H14F3N3O2 — CID 67383215
(4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-(2-fluoro-4-pyridinyl)spiro[5H-1,3-oxazole-4,9'-xanthene] (PubChem CID 67383215) has the molecular formula C25H14F3N3O2 and a molecular weight of 445.40 g/mol. Its IUPAC name is (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-(2-fluoro-4-pyridinyl)spiro[5H-1,3-oxazole-4,9'-xanthene].
| Compound Name | (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-(2-fluoro-4-pyridinyl)spiro[5H-1,3-oxazole-4,9'-xanthene] |
|---|---|
| PubChem CID | 67383215 |
| Molecular Formula | C25H14F3N3O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-(2-fluoro-4-pyridinyl)spiro[5H-1,3-oxazole-4,9'-xanthene] |
| SMILES | Fc1cc(-c2cc(F)c3c(c2)[C@]2(COC=N2)c2cc(-c4cccnc4F)ccc2O3)ccn1 |
| InChI | InChI=1S/C25H14F3N3O2/c26-20-10-16(14-5-7-29-22(27)11-14)9-19-23(20)33-21-4-3-15(17-2-1-6-30-24(17)28)8-18(21)25(19)12-32-13-31-25/h1-11,13H,12H2/t25-/m0/s1 |
| InChIKey | LVNPSOUPSHCSSX-VWLOTQADSA-N |
| XLogP | 5.64 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|