C21H15F2N3O3 — CID 67438769
5-amino-5'-fluoro-7'-(2-fluoro-4-pyridinyl)spiro[2,6-dihydro-1,4-oxazine-3,9'-xanthene]-2'-ol (PubChem CID 67438769) has the molecular formula C21H15F2N3O3 and a molecular weight of 395.37 g/mol. Its IUPAC name is 5-amino-5'-fluoro-7'-(2-fluoro-4-pyridinyl)spiro[2,6-dihydro-1,4-oxazine-3,9'-xanthene]-2'-ol.
| Compound Name | 5-amino-5'-fluoro-7'-(2-fluoro-4-pyridinyl)spiro[2,6-dihydro-1,4-oxazine-3,9'-xanthene]-2'-ol |
|---|---|
| PubChem CID | 67438769 |
| Molecular Formula | C21H15F2N3O3 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 5-amino-5'-fluoro-7'-(2-fluoro-4-pyridinyl)spiro[2,6-dihydro-1,4-oxazine-3,9'-xanthene]-2'-ol |
| SMILES | NC1=NC2(COC1)c1cc(O)ccc1Oc1c(F)cc(-c3ccnc(F)c3)cc12 |
| InChI | InChI=1S/C21H15F2N3O3/c22-16-6-12(11-3-4-25-18(23)7-11)5-15-20(16)29-17-2-1-13(27)8-14(17)21(15)10-28-9-19(24)26-21/h1-8,27H,9-10H2,(H2,24,26) |
| InChIKey | LGEBKHKXRUYYQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|