C25H22F2N4O3 — CID 58465957
(4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-morpholin-4-ylspiro[5,6-dihydro-1,3-oxazine-4,9'-xanthene]-2-amine (PubChem CID 58465957) has the molecular formula C25H22F2N4O3 and a molecular weight of 464.47 g/mol. Its IUPAC name is (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-morpholin-4-ylspiro[5,6-dihydro-1,3-oxazine-4,9'-xanthene]-2-amine.
| Compound Name | (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-morpholin-4-ylspiro[5,6-dihydro-1,3-oxazine-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 58465957 |
| Molecular Formula | C25H22F2N4O3 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (4S)-4'-fluoro-7'-(2-fluoro-3-pyridinyl)-2'-morpholin-4-ylspiro[5,6-dihydro-1,3-oxazine-4,9'-xanthene]-2-amine |
| SMILES | NC1=N[C@@]2(CCO1)c1cc(-c3cccnc3F)ccc1Oc1c(F)cc(N3CCOCC3)cc12 |
| InChI | InChI=1S/C25H22F2N4O3/c26-20-14-16(31-7-10-32-11-8-31)13-19-22(20)34-21-4-3-15(17-2-1-6-29-23(17)27)12-18(21)25(19)5-9-33-24(28)30-25/h1-4,6,12-14H,5,7-11H2,(H2,28,30)/t25-/m0/s1 |
| InChIKey | QGYKPQCDNGIDBU-VWLOTQADSA-N |
| XLogP | 3.95 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|