C24H19F3N4O3 — CID 67438609
3',5'-difluoro-2'-(2-fluoro-3-pyridinyl)-7'-morpholin-4-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 67438609) has the molecular formula C24H19F3N4O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is 3',5'-difluoro-2'-(2-fluoro-3-pyridinyl)-7'-morpholin-4-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
| Compound Name | 3',5'-difluoro-2'-(2-fluoro-3-pyridinyl)-7'-morpholin-4-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
|---|---|
| PubChem CID | 67438609 |
| Molecular Formula | C24H19F3N4O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3',5'-difluoro-2'-(2-fluoro-3-pyridinyl)-7'-morpholin-4-ylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CO1)c1cc(-c3cccnc3F)c(F)cc1Oc1c(F)cc(N3CCOCC3)cc12 |
| InChI | InChI=1S/C24H19F3N4O3/c25-18-11-20-16(10-15(18)14-2-1-3-29-22(14)27)24(12-33-23(28)30-24)17-8-13(9-19(26)21(17)34-20)31-4-6-32-7-5-31/h1-3,8-11H,4-7,12H2,(H2,28,30) |
| InChIKey | LWYQWLMIJMEFGB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|