C31H22F2N4O7S — CID 67393772
4-(ethylsulfonylamino)-5-[3-(4-fluoro-1,3-benzoxazol-2-yl)-4-nitrophenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 67393772) has the molecular formula C31H22F2N4O7S and a molecular weight of 632.60 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-5-[3-(4-fluoro-1,3-benzoxazol-2-yl)-4-nitrophenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 4-(ethylsulfonylamino)-5-[3-(4-fluoro-1,3-benzoxazol-2-yl)-4-nitrophenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 67393772 |
| Molecular Formula | C31H22F2N4O7S |
| Molecular Weight | 632.60 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | 4-(ethylsulfonylamino)-5-[3-(4-fluoro-1,3-benzoxazol-2-yl)-4-nitrophenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CCS(=O)(=O)Nc1c(-c2ccc([N+](=O)[O-])c(-c3nc4c(F)cccc4o3)c2)ccc2oc(-c3ccc(F)cc3)c(C(=O)NC)c12 |
| InChI | InChI=1S/C31H22F2N4O7S/c1-3-45(41,42)36-27-19(12-14-23-25(27)26(30(38)34-2)29(43-23)16-7-10-18(32)11-8-16)17-9-13-22(37(39)40)20(15-17)31-35-28-21(33)5-4-6-24(28)44-31/h4-15,36H,3H2,1-2H3,(H,34,38) |
| InChIKey | QOZFJBLDFZLCBP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|