C25H25FN4O4 — CID 67394652
(4-nitrophenyl) N-[2-[1-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate (PubChem CID 67394652) has the molecular formula C25H25FN4O4 and a molecular weight of 464.50 g/mol. Its IUPAC name is (4-nitrophenyl) N-[2-[1-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[2-[1-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 67394652 |
| Molecular Formula | C25H25FN4O4 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (4-nitrophenyl) N-[2-[1-[6-(4-fluorophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate |
| SMILES | O=C(NCCC1CCN(c2cccc(-c3ccc(F)cc3)n2)CC1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H25FN4O4/c26-20-6-4-19(5-7-20)23-2-1-3-24(28-23)29-16-13-18(14-17-29)12-15-27-25(31)34-22-10-8-21(9-11-22)30(32)33/h1-11,18H,12-17H2,(H,27,31) |
| InChIKey | HESLMYKRXFWTSF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|