C24H31NO4 — CID 67394896
methyl (E)-3-[4-[[2-(2-adamantyl)ethoxycarbonylamino]methyl]phenyl]prop-2-enoate (PubChem CID 67394896) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl (E)-3-[4-[[2-(2-adamantyl)ethoxycarbonylamino]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[2-(2-adamantyl)ethoxycarbonylamino]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67394896 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | methyl (E)-3-[4-[[2-(2-adamantyl)ethoxycarbonylamino]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CNC(=O)OCCC2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-28-23(26)7-6-16-2-4-17(5-3-16)15-25-24(27)29-9-8-22-20-11-18-10-19(13-20)14-21(22)12-18/h2-7,18-22H,8-15H2,1H3,(H,25,27)/b7-6+ |
| InChIKey | FTQJOPXYWXYXAD-VOTSOKGWSA-N |
| XLogP | 4.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|