C44H76O3 — CID 67397907
ethyl (Z)-2-[4-[(Z)-octadec-9-enoxy]phenyl]octadec-9-enoate (PubChem CID 67397907) has the molecular formula C44H76O3 and a molecular weight of 653.09 g/mol. Its IUPAC name is ethyl (Z)-2-[4-[(Z)-octadec-9-enoxy]phenyl]octadec-9-enoate.
| Compound Name | ethyl (Z)-2-[4-[(Z)-octadec-9-enoxy]phenyl]octadec-9-enoate |
|---|---|
| PubChem CID | 67397907 |
| Molecular Formula | C44H76O3 |
| Molecular Weight | 653.09 g/mol |
| Exact Mass | 652.58 |
| IUPAC Name | ethyl (Z)-2-[4-[(Z)-octadec-9-enoxy]phenyl]octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOc1ccc(C(CCCCCC/C=C\CCCCCCCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C44H76O3/c1-4-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-40-47-42-38-36-41(37-39-42)43(44(45)46-6-3)35-33-31-29-27-25-23-20-18-16-14-12-10-8-5-2/h19-21,23,36-39,43H,4-18,22,24-35,40H2,1-3H3/b21-19-,23-20- |
| InChIKey | PLHXFEXFVWTSTN-XNMGEWHASA-N |
| XLogP | 14.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.09 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|