C26H20Br4N4O2S — CID 67402937
4,9-dibromo-6,7-bis[4-(3-bromopropoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 67402937) has the molecular formula C26H20Br4N4O2S and a molecular weight of 772.15 g/mol. Its IUPAC name is 4,9-dibromo-6,7-bis[4-(3-bromopropoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-dibromo-6,7-bis[4-(3-bromopropoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 67402937 |
| Molecular Formula | C26H20Br4N4O2S |
| Molecular Weight | 772.15 g/mol |
| Exact Mass | 767.80 |
| IUPAC Name | 4,9-dibromo-6,7-bis[4-(3-bromopropoxy)phenyl]-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | BrCCCOc1ccc(-c2nc3c(Br)c4nsnc4c(Br)c3nc2-c2ccc(OCCCBr)cc2)cc1 |
| InChI | InChI=1S/C26H20Br4N4O2S/c27-11-1-13-35-17-7-3-15(4-8-17)21-22(16-5-9-18(10-6-16)36-14-2-12-28)32-24-20(30)26-25(33-37-34-26)19(29)23(24)31-21/h3-10H,1-2,11-14H2 |
| InChIKey | MEFYXBRPCAFWBJ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.15 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|