About [2,3-di(propan-2-yl)phenyl] diphenyl phosphate
[2,3-di(propan-2-yl)phenyl] diphenyl phosphate (PubChem CID 67406044) has the molecular formula C24H27O4P
and a molecular weight of 410.45 g/mol. Its IUPAC name is [2,3-di(propan-2-yl)phenyl] diphenyl phosphate.
Molecular Properties
| Compound Name | [2,3-di(propan-2-yl)phenyl] diphenyl phosphate |
| PubChem CID | 67406044 |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [2,3-di(propan-2-yl)phenyl] diphenyl phosphate |
| SMILES | CC(C)c1cccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C24H27O4P/c1-18(2)22-16-11-17-23(24(22)19(3)4)28-29(25,26-20-12-7-5-8-13-20)27-21-14-9-6-10-15-21/h5-19H,1-4H3 |
| InChIKey | PFZZYSFEOJLJQQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-di(propan-2-yl)phenyl] diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-di(propan-2-yl)phenyl] diphenyl phosphate?
The IUPAC name of [2,3-di(propan-2-yl)phenyl] diphenyl phosphate (CID 67406044) is [2,3-di(propan-2-yl)phenyl] diphenyl phosphate.
What is the SMILES notation for [2,3-di(propan-2-yl)phenyl] diphenyl phosphate?
The canonical SMILES for [2,3-di(propan-2-yl)phenyl] diphenyl phosphate is CC(C)c1cccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)c1C(C)C.
What is the InChIKey of [2,3-di(propan-2-yl)phenyl] diphenyl phosphate?
The InChIKey is PFZZYSFEOJLJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27O4P/c1-18(2)22-16-11-17-23(24(22)19(3)4)28-29(25,26-20-12-7-5-8-13-20)27-21-14-9-6-10-15-21/h5-19H,1-4H3.
What are the key properties of [2,3-di(propan-2-yl)phenyl] diphenyl phosphate?
[2,3-di(propan-2-yl)phenyl] diphenyl phosphate has a molecular weight of 410.45 g/mol, XLogP of 7.58, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-di(propan-2-yl)phenyl] diphenyl phosphate is sourced from PubChem (CID 67406044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).