C18H11FN2O2 — CID 67409444
5-fluoro-N-naphthalen-2-yl-1,2-benzoxazole-3-carboxamide (PubChem CID 67409444) has the molecular formula C18H11FN2O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 5-fluoro-N-naphthalen-2-yl-1,2-benzoxazole-3-carboxamide.
| Compound Name | 5-fluoro-N-naphthalen-2-yl-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 67409444 |
| Molecular Formula | C18H11FN2O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-fluoro-N-naphthalen-2-yl-1,2-benzoxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1noc2ccc(F)cc12 |
| InChI | InChI=1S/C18H11FN2O2/c19-13-6-8-16-15(10-13)17(21-23-16)18(22)20-14-7-5-11-3-1-2-4-12(11)9-14/h1-10H,(H,20,22) |
| InChIKey | YZTIBNIRSRUQQJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |