C18H19N3O7S2 — CID 67410574
2-[2-[(2R)-2-[(4-methoxy-2-nitrophenoxy)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67410574) has the molecular formula C18H19N3O7S2 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[(4-methoxy-2-nitrophenoxy)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2R)-2-[(4-methoxy-2-nitrophenoxy)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67410574 |
| Molecular Formula | C18H19N3O7S2 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-[2-[(2R)-2-[(4-methoxy-2-nitrophenoxy)methyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | COc1ccc(OC[C@H]2CCC(=O)N2CCSc2nc(C(=O)O)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O7S2/c1-27-12-3-4-15(14(8-12)21(25)26)28-9-11-2-5-16(22)20(11)6-7-29-18-19-13(10-30-18)17(23)24/h3-4,8,10-11H,2,5-7,9H2,1H3,(H,23,24)/t11-/m1/s1 |
| InChIKey | SHPPRNVYEKTXGK-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|