C23H25N7O4 — CID 67415754
[3-[[3-[5-(2-methoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] N-propylcarbamate (PubChem CID 67415754) has the molecular formula C23H25N7O4 and a molecular weight of 463.50 g/mol. Its IUPAC name is [3-[[3-[5-(2-methoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] N-propylcarbamate.
| Compound Name | [3-[[3-[5-(2-methoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 67415754 |
| Molecular Formula | C23H25N7O4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [3-[[3-[5-(2-methoxyethoxy)pyrimidin-2-yl]phenyl]methyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc2nnc(Cc3cccc(-c4ncc(OCCOC)cn4)c3)n2n1 |
| InChI | InChI=1S/C23H25N7O4/c1-3-9-24-23(31)34-21-8-7-19-27-28-20(30(19)29-21)13-16-5-4-6-17(12-16)22-25-14-18(15-26-22)33-11-10-32-2/h4-8,12,14-15H,3,9-11,13H2,1-2H3,(H,24,31) |
| InChIKey | UQIQCPAULPJYLP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|