C17H13IN6O — CID 58477191
3-[[3-(5-iodopyrimidin-2-yl)phenyl]methyl]-6-methoxy-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 58477191) has the molecular formula C17H13IN6O and a molecular weight of 444.24 g/mol. Its IUPAC name is 3-[[3-(5-iodopyrimidin-2-yl)phenyl]methyl]-6-methoxy-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[[3-(5-iodopyrimidin-2-yl)phenyl]methyl]-6-methoxy-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 58477191 |
| Molecular Formula | C17H13IN6O |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 3-[[3-(5-iodopyrimidin-2-yl)phenyl]methyl]-6-methoxy-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | COc1ccc2nnc(Cc3cccc(-c4ncc(I)cn4)c3)n2n1 |
| InChI | InChI=1S/C17H13IN6O/c1-25-16-6-5-14-21-22-15(24(14)23-16)8-11-3-2-4-12(7-11)17-19-9-13(18)10-20-17/h2-7,9-10H,8H2,1H3 |
| InChIKey | DYCREVIJZOIHEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|