C23H26N6O2 — CID 67423689
4-(benzylamino)-6-[4-(propan-2-ylcarbamoylamino)anilino]pyridine-3-carboxamide (PubChem CID 67423689) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-(benzylamino)-6-[4-(propan-2-ylcarbamoylamino)anilino]pyridine-3-carboxamide.
| Compound Name | 4-(benzylamino)-6-[4-(propan-2-ylcarbamoylamino)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67423689 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-(benzylamino)-6-[4-(propan-2-ylcarbamoylamino)anilino]pyridine-3-carboxamide |
| SMILES | CC(C)NC(=O)Nc1ccc(Nc2cc(NCc3ccccc3)c(C(N)=O)cn2)cc1 |
| InChI | InChI=1S/C23H26N6O2/c1-15(2)27-23(31)29-18-10-8-17(9-11-18)28-21-12-20(19(14-26-21)22(24)30)25-13-16-6-4-3-5-7-16/h3-12,14-15H,13H2,1-2H3,(H2,24,30)(H2,25,26,28)(H2,27,29,31) |
| InChIKey | MGBMTLLYZQMMEZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |