C21H16Cl2INO3 — CID 67423904
CID 67423904 (PubChem CID 67423904) has the molecular formula C21H16Cl2INO3 and a molecular weight of 528.17 g/mol.
| Compound Name | CID 67423904 |
|---|---|
| PubChem CID | 67423904 |
| Molecular Formula | C21H16Cl2INO3 |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | — |
| SMILES | O=C1Nc2cc(Cl)ccc2[C@@]12C=C(I)C1(C[C@H]2c2cccc(Cl)c2)OCCO1 |
| InChI | InChI=1S/C21H16Cl2INO3/c22-13-3-1-2-12(8-13)16-10-21(27-6-7-28-21)18(24)11-20(16)15-5-4-14(23)9-17(15)25-19(20)26/h1-5,8-9,11,16H,6-7,10H2,(H,25,26)/t16-,20+/m0/s1 |
| InChIKey | AGNIUOUSPVPOPX-OXJNMPFZSA-N |
| XLogP | 5.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|