C18H17ClFNS — CID 67423993
3-(5-fluoro-1-benzothiophen-2-yl)-1-phenylbut-3-en-1-amine;hydrochloride (PubChem CID 67423993) has the molecular formula C18H17ClFNS and a molecular weight of 333.86 g/mol. Its IUPAC name is 3-(5-fluoro-1-benzothiophen-2-yl)-1-phenylbut-3-en-1-amine;hydrochloride.
| Compound Name | 3-(5-fluoro-1-benzothiophen-2-yl)-1-phenylbut-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67423993 |
| Molecular Formula | C18H17ClFNS |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-(5-fluoro-1-benzothiophen-2-yl)-1-phenylbut-3-en-1-amine;hydrochloride |
| SMILES | C=C(CC(N)c1ccccc1)c1cc2cc(F)ccc2s1.Cl |
| InChI | InChI=1S/C18H16FNS.ClH/c1-12(9-16(20)13-5-3-2-4-6-13)18-11-14-10-15(19)7-8-17(14)21-18;/h2-8,10-11,16H,1,9,20H2;1H |
| InChIKey | IFRXMDXOEYTETD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |