C16H24ClNS — CID 67425572
(2R)-1-(2-benzothiophen-1-yl)-N-propylpentan-2-amine;hydrochloride (PubChem CID 67425572) has the molecular formula C16H24ClNS and a molecular weight of 297.89 g/mol. Its IUPAC name is (2R)-1-(2-benzothiophen-1-yl)-N-propylpentan-2-amine;hydrochloride.
| Compound Name | (2R)-1-(2-benzothiophen-1-yl)-N-propylpentan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67425572 |
| Molecular Formula | C16H24ClNS |
| Molecular Weight | 297.89 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2R)-1-(2-benzothiophen-1-yl)-N-propylpentan-2-amine;hydrochloride |
| SMILES | CCCN[C@H](CCC)Cc1scc2ccccc12.Cl |
| InChI | InChI=1S/C16H23NS.ClH/c1-3-7-14(17-10-4-2)11-16-15-9-6-5-8-13(15)12-18-16;/h5-6,8-9,12,14,17H,3-4,7,10-11H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | MDPOFVILEMUBFZ-PFEQFJNWSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |