C13H13ClF4O3 — CID 67425886
2-chloro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]hexanoic acid (PubChem CID 67425886) has the molecular formula C13H13ClF4O3 and a molecular weight of 328.69 g/mol. Its IUPAC name is 2-chloro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]hexanoic acid.
| Compound Name | 2-chloro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 67425886 |
| Molecular Formula | C13H13ClF4O3 |
| Molecular Weight | 328.69 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-chloro-2-[3-fluoro-4-(trifluoromethoxy)phenyl]hexanoic acid |
| SMILES | CCCCC(Cl)(C(=O)O)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C13H13ClF4O3/c1-2-3-6-12(14,11(19)20)8-4-5-10(9(15)7-8)21-13(16,17)18/h4-5,7H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | VEXPLGOYLIPIJJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|