C15H22O2 — CID 67426951
6-(cycloocten-1-yl)-2,3,4,5-tetrahydrooxocin-8-one (PubChem CID 67426951) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 6-(cycloocten-1-yl)-2,3,4,5-tetrahydrooxocin-8-one.
| Compound Name | 6-(cycloocten-1-yl)-2,3,4,5-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 67426951 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 6-(cycloocten-1-yl)-2,3,4,5-tetrahydrooxocin-8-one |
| SMILES | O=C1C=C(C2=CCCCCCC2)CCCCO1 |
| InChI | InChI=1S/C15H22O2/c16-15-12-14(10-6-7-11-17-15)13-8-4-2-1-3-5-9-13/h8,12H,1-7,9-11H2 |
| InChIKey | UINUSHCTSWLJAH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |