C18H27NO5 — CID 67428547
2-[(1R,2R,3R)-2-(2-cyanoethyl)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetic acid (PubChem CID 67428547) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(1R,2R,3R)-2-(2-cyanoethyl)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R)-2-(2-cyanoethyl)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetic acid |
|---|---|
| PubChem CID | 67428547 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[(1R,2R,3R)-2-(2-cyanoethyl)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]acetic acid |
| SMILES | CCCCC[C@H](O)C=C[C@@]1(CCC#N)[C@H](O)CC(=O)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C18H27NO5/c1-2-3-4-6-13(20)7-9-18(8-5-10-19)14(11-17(23)24)15(21)12-16(18)22/h7,9,13-14,16,20,22H,2-6,8,11-12H2,1H3,(H,23,24)/t13-,14-,16+,18+/m0/s1 |
| InChIKey | WEDAWRLDYUZXCR-KJGCVMFHSA-N |
| XLogP | 2.20 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|