C16H25NO3 — CID 90300942
3-[(1R,2R)-2-hydroxy-1-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopentyl]propanenitrile (PubChem CID 90300942) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-[(1R,2R)-2-hydroxy-1-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopentyl]propanenitrile.
| Compound Name | 3-[(1R,2R)-2-hydroxy-1-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopentyl]propanenitrile |
|---|---|
| PubChem CID | 90300942 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-[(1R,2R)-2-hydroxy-1-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopentyl]propanenitrile |
| SMILES | CCCCC[C@H](O)/C=C/[C@@]1(CCC#N)CC(=O)C[C@H]1O |
| InChI | InChI=1S/C16H25NO3/c1-2-3-4-6-13(18)7-9-16(8-5-10-17)12-14(19)11-15(16)20/h7,9,13,15,18,20H,2-6,8,11-12H2,1H3/b9-7+/t13-,15+,16-/m0/s1 |
| InChIKey | QKEPWTXMGOQPEB-JNEVMBLZSA-N |
| XLogP | 2.50 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|