C19H36O3 — CID 70620028
trans-(1R,2R)-2-(6-hydroxyhexyl)-2-[(E)-3-hydroxyoct-1-enyl]cyclopentan-1-ol (PubChem CID 70620028) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is trans-(1R,2R)-2-(6-hydroxyhexyl)-2-[(E)-3-hydroxyoct-1-enyl]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(6-hydroxyhexyl)-2-[(E)-3-hydroxyoct-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 70620028 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | trans-(1R,2R)-2-(6-hydroxyhexyl)-2-[(E)-3-hydroxyoct-1-enyl]cyclopentan-1-ol |
| SMILES | CCCCCC(O)/C=C/[C@@]1(CCCCCCO)CCC[C@H]1O |
| InChI | InChI=1S/C19H36O3/c1-2-3-6-10-17(21)12-15-19(14-9-11-18(19)22)13-7-4-5-8-16-20/h12,15,17-18,20-22H,2-11,13-14,16H2,1H3/b15-12+/t17?,18-,19-/m1/s1 |
| InChIKey | FHJPRPPQNROYJT-CDCVGAGASA-N |
| XLogP | 3.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|