C16H28O2 — CID 91510295
6a-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol (PubChem CID 91510295) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 6a-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol.
| Compound Name | 6a-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 91510295 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 6a-[(3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-ol |
| SMILES | CCCCC[C@H](O)C=CC12CCCC1CC(O)C2 |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-7-14(17)8-10-16-9-5-6-13(16)11-15(18)12-16/h8,10,13-15,17-18H,2-7,9,11-12H2,1H3/t13?,14-,15?,16?/m0/s1 |
| InChIKey | NLUSTVZHTODJNT-KXVRIMHRSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|