C16H27O4- — CID 172675778
2-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]acetate (PubChem CID 172675778) has the molecular formula C16H27O4- and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]acetate.
| Compound Name | 2-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 172675778 |
| Molecular Formula | C16H27O4- |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-[(1R,3S)-1-hydroxy-3-[(E)-3-hydroxyoct-1-enyl]cyclohexyl]acetate |
| SMILES | CCCCCC(O)/C=C/[C@H]1CCC[C@](O)(CC(=O)[O-])C1 |
| InChI | InChI=1S/C16H28O4/c1-2-3-4-7-14(17)9-8-13-6-5-10-16(20,11-13)12-15(18)19/h8-9,13-14,17,20H,2-7,10-12H2,1H3,(H,18,19)/p-1/b9-8+/t13-,14?,16-/m1/s1 |
| InChIKey | WBWCYGPCAAUUOR-RDOFEVMYSA-M |
| XLogP | 1.55 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|