C22H31NaO4 — CID 101014570
sodium 2-[(1S,3S)-1-hydroxy-3-[(E,3R)-3-hydroxy-7-phenyloct-1-enyl]cyclohexyl]acetate (PubChem CID 101014570) has the molecular formula C22H31NaO4 and a molecular weight of 382.48 g/mol. Its IUPAC name is sodium 2-[(1S,3S)-1-hydroxy-3-[(E,3R)-3-hydroxy-7-phenyloct-1-enyl]cyclohexyl]acetate.
| Compound Name | sodium 2-[(1S,3S)-1-hydroxy-3-[(E,3R)-3-hydroxy-7-phenyloct-1-enyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 101014570 |
| Molecular Formula | C22H31NaO4 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | sodium 2-[(1S,3S)-1-hydroxy-3-[(E,3R)-3-hydroxy-7-phenyloct-1-enyl]cyclohexyl]acetate |
| SMILES | CC(CCC[C@@H](O)/C=C/[C@H]1CCC[C@@](O)(CC(=O)[O-])C1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C22H32O4.Na/c1-17(19-9-3-2-4-10-19)7-5-11-20(23)13-12-18-8-6-14-22(26,15-18)16-21(24)25;/h2-4,9-10,12-13,17-18,20,23,26H,5-8,11,14-16H2,1H3,(H,24,25);/q;+1/p-1/b13-12+;/t17?,18-,20-,22+;/m1./s1 |
| InChIKey | NWMPSSNSDUHOCK-SEGUFBODSA-M |
| XLogP | -0.06 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|