C23H34O4 — CID 56974899
2-[(1S,3S)-2-ethyl-1-hydroxy-3-(3-hydroxy-7-phenylhept-1-enyl)cyclohexyl]acetic acid (PubChem CID 56974899) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[(1S,3S)-2-ethyl-1-hydroxy-3-(3-hydroxy-7-phenylhept-1-enyl)cyclohexyl]acetic acid.
| Compound Name | 2-[(1S,3S)-2-ethyl-1-hydroxy-3-(3-hydroxy-7-phenylhept-1-enyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 56974899 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[(1S,3S)-2-ethyl-1-hydroxy-3-(3-hydroxy-7-phenylhept-1-enyl)cyclohexyl]acetic acid |
| SMILES | CCC1C(C=CC(O)CCCCc2ccccc2)CCC[C@]1(O)CC(=O)O |
| InChI | InChI=1S/C23H34O4/c1-2-21-19(12-8-16-23(21,27)17-22(25)26)14-15-20(24)13-7-6-11-18-9-4-3-5-10-18/h3-5,9-10,14-15,19-21,24,27H,2,6-8,11-13,16-17H2,1H3,(H,25,26)/t19?,20?,21?,23-/m0/s1 |
| InChIKey | QJFFDZWLTDYDRF-FTKYIGPGSA-N |
| XLogP | 4.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|