C21H32O4 — CID 101014588
2-[(1S,3S)-1-hydroxy-3-[(3R)-3-hydroxy-7-phenylheptyl]cyclohexyl]acetic acid (PubChem CID 101014588) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[(1S,3S)-1-hydroxy-3-[(3R)-3-hydroxy-7-phenylheptyl]cyclohexyl]acetic acid.
| Compound Name | 2-[(1S,3S)-1-hydroxy-3-[(3R)-3-hydroxy-7-phenylheptyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 101014588 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[(1S,3S)-1-hydroxy-3-[(3R)-3-hydroxy-7-phenylheptyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)C[C@]1(O)CCC[C@@H](CC[C@H](O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H32O4/c22-19(11-5-4-9-17-7-2-1-3-8-17)13-12-18-10-6-14-21(25,15-18)16-20(23)24/h1-3,7-8,18-19,22,25H,4-6,9-16H2,(H,23,24)/t18-,19+,21-/m0/s1 |
| InChIKey | WTVVKTQFEBUYJK-ZVDOUQERSA-N |
| XLogP | 3.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|