C25H35O4- — CID 22074454
2-[1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]acetate (PubChem CID 22074454) has the molecular formula C25H35O4- and a molecular weight of 399.55 g/mol. Its IUPAC name is 2-[1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]acetate.
| Compound Name | 2-[1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 22074454 |
| Molecular Formula | C25H35O4- |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-[1-hydroxy-3-[(E)-3-hydroxy-7-phenylhept-1-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-yl]acetate |
| SMILES | O=C([O-])CC1(O)CC(/C=C/C(O)CCCCc2ccccc2)CC2CCCCC21 |
| InChI | InChI=1S/C25H36O4/c26-22(12-6-4-10-19-8-2-1-3-9-19)15-14-20-16-21-11-5-7-13-23(21)25(29,17-20)18-24(27)28/h1-3,8-9,14-15,20-23,26,29H,4-7,10-13,16-18H2,(H,27,28)/p-1/b15-14+ |
| InChIKey | JWGSEAIOFFWZKC-CCEZHUSRSA-M |
| XLogP | 3.40 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|