C24H34FNO4 — CID 123393422
7-[3-fluoro-5-(3-hydroxy-7-phenylhept-1-enyl)-2-oxopyrrolidin-1-yl]heptanoic acid (PubChem CID 123393422) has the molecular formula C24H34FNO4 and a molecular weight of 419.54 g/mol. Its IUPAC name is 7-[3-fluoro-5-(3-hydroxy-7-phenylhept-1-enyl)-2-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[3-fluoro-5-(3-hydroxy-7-phenylhept-1-enyl)-2-oxopyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 123393422 |
| Molecular Formula | C24H34FNO4 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 7-[3-fluoro-5-(3-hydroxy-7-phenylhept-1-enyl)-2-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)C(F)CC1C=CC(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C24H34FNO4/c25-22-18-20(26(24(22)30)17-9-2-1-6-14-23(28)29)15-16-21(27)13-8-7-12-19-10-4-3-5-11-19/h3-5,10-11,15-16,20-22,27H,1-2,6-9,12-14,17-18H2,(H,28,29) |
| InChIKey | IZSZGHRDPPUBKH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|