C27H44O4Si — CID 22074432
2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-1-enyl]-1-hydroxycyclohexyl]acetic acid (PubChem CID 22074432) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-1-enyl]-1-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-1-enyl]-1-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22074432 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 2-[3-[(E)-3-[tert-butyl(dimethyl)silyl]oxy-7-phenylhept-1-enyl]-1-hydroxycyclohexyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C/C1CCCC(O)(CC(=O)O)C1)CCCCc1ccccc1 |
| InChI | InChI=1S/C27H44O4Si/c1-26(2,3)32(4,5)31-24(16-10-9-14-22-12-7-6-8-13-22)18-17-23-15-11-19-27(30,20-23)21-25(28)29/h6-8,12-13,17-18,23-24,30H,9-11,14-16,19-21H2,1-5H3,(H,28,29)/b18-17+ |
| InChIKey | QFPPDVVXZAYGPV-ISLYRVAYSA-N |
| XLogP | 6.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|