About 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid
4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid (PubChem CID 57003370) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid.
Molecular Properties
| Compound Name | 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid |
| PubChem CID | 57003370 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid |
| SMILES | CCCCCC(O)C=C[C@H]1CCC[C@@](O)(CCCC(=O)O)C1 |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-8-16(19)11-10-15-7-5-12-18(22,14-15)13-6-9-17(20)21/h10-11,15-16,19,22H,2-9,12-14H2,1H3,(H,20,21)/t15-,16?,18-/m1/s1 |
| InChIKey | QFCVPPANICHFQZ-IFJNFQAOSA-N |
| XLogP | 3.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid?
The IUPAC name of 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid (CID 57003370) is 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid.
What is the SMILES notation for 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid?
The canonical SMILES for 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid is CCCCCC(O)C=C[C@H]1CCC[C@@](O)(CCCC(=O)O)C1.
What is the InChIKey of 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid?
The InChIKey is QFCVPPANICHFQZ-IFJNFQAOSA-N. The full InChI is InChI=1S/C18H32O4/c1-2-3-4-8-16(19)11-10-15-7-5-12-18(22,14-15)13-6-9-17(20)21/h10-11,15-16,19,22H,2-9,12-14H2,1H3,(H,20,21)/t15-,16?,18-/m1/s1.
What are the key properties of 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid?
4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid has a molecular weight of 312.45 g/mol, XLogP of 3.66, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,3S)-1-hydroxy-3-(3-hydroxyoct-1-enyl)cyclohexyl]butanoic acid is sourced from PubChem (CID 57003370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).