C15H26O2S — CID 141034308
6a-[(E,3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]thiophen-5-ol (PubChem CID 141034308) has the molecular formula C15H26O2S and a molecular weight of 270.44 g/mol. Its IUPAC name is 6a-[(E,3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]thiophen-5-ol.
| Compound Name | 6a-[(E,3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]thiophen-5-ol |
|---|---|
| PubChem CID | 141034308 |
| Molecular Formula | C15H26O2S |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 6a-[(E,3S)-3-hydroxyoct-1-enyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]thiophen-5-ol |
| SMILES | CCCCC[C@H](O)/C=C/C12CC(O)CC1CCS2 |
| InChI | InChI=1S/C15H26O2S/c1-2-3-4-5-13(16)6-8-15-11-14(17)10-12(15)7-9-18-15/h6,8,12-14,16-17H,2-5,7,9-11H2,1H3/b8-6+/t12?,13-,14?,15?/m0/s1 |
| InChIKey | GFGVFLRKOGZLDA-ZUBASSFBSA-N |
| XLogP | 3.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|