C38H42N10O2S — CID 67432610
N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-[1,2,4]triazino[1,6-a]indol-2-amine;2-methylsulfinyl-[1,2,4]triazino[1,6-a]indole (PubChem CID 67432610) has the molecular formula C38H42N10O2S and a molecular weight of 702.89 g/mol. Its IUPAC name is N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-[1,2,4]triazino[1,6-a]indol-2-amine;2-methylsulfinyl-[1,2,4]triazino[1,6-a]indole.
| Compound Name | N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-[1,2,4]triazino[1,6-a]indol-2-amine;2-methylsulfinyl-[1,2,4]triazino[1,6-a]indole |
|---|---|
| PubChem CID | 67432610 |
| Molecular Formula | C38H42N10O2S |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-[1,2,4]triazino[1,6-a]indol-2-amine;2-methylsulfinyl-[1,2,4]triazino[1,6-a]indole |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc2cc3ccccc3n2n1.CS(=O)c1ncc2cc3ccccc3n2n1 |
| InChI | InChI=1S/C27H33N7O.C11H9N3OS/c1-31-13-15-33(16-14-31)21-9-11-32(12-10-21)22-7-8-24(26(18-22)35-2)29-27-28-19-23-17-20-5-3-4-6-25(20)34(23)30-27;1-16(15)11-12-7-9-6-8-4-2-3-5-10(8)14(9)13-11/h3-8,17-19,21H,9-16H2,1-2H3,(H,29,30);2-7H,1H3 |
| InChIKey | KQPAIWCSWPBMNY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |