C20H26N4O6S — CID 67432973
2-[5-amino-6-(3-morpholin-4-ylpropyl)-5-nitrocyclohexa-1,3-dien-1-yl]sulfonylbenzamide (PubChem CID 67432973) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[5-amino-6-(3-morpholin-4-ylpropyl)-5-nitrocyclohexa-1,3-dien-1-yl]sulfonylbenzamide.
| Compound Name | 2-[5-amino-6-(3-morpholin-4-ylpropyl)-5-nitrocyclohexa-1,3-dien-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67432973 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[5-amino-6-(3-morpholin-4-ylpropyl)-5-nitrocyclohexa-1,3-dien-1-yl]sulfonylbenzamide |
| SMILES | NC(=O)c1ccccc1S(=O)(=O)C1=CC=CC(N)([N+](=O)[O-])C1CCCN1CCOCC1 |
| InChI | InChI=1S/C20H26N4O6S/c21-19(25)15-5-1-2-7-17(15)31(28,29)18-8-3-9-20(22,24(26)27)16(18)6-4-10-23-11-13-30-14-12-23/h1-3,5,7-9,16H,4,6,10-14,22H2,(H2,21,25) |
| InChIKey | NCCGSKUMYOCZQG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 158.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|