C21H21NO6 — CID 67441607
3-(2-oxopropoxy)-5-[phenylmethoxycarbonyl(prop-2-enyl)amino]benzoic acid (PubChem CID 67441607) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(2-oxopropoxy)-5-[phenylmethoxycarbonyl(prop-2-enyl)amino]benzoic acid.
| Compound Name | 3-(2-oxopropoxy)-5-[phenylmethoxycarbonyl(prop-2-enyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67441607 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-(2-oxopropoxy)-5-[phenylmethoxycarbonyl(prop-2-enyl)amino]benzoic acid |
| SMILES | C=CCN(C(=O)OCc1ccccc1)c1cc(OCC(C)=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C21H21NO6/c1-3-9-22(21(26)28-14-16-7-5-4-6-8-16)18-10-17(20(24)25)11-19(12-18)27-13-15(2)23/h3-8,10-12H,1,9,13-14H2,2H3,(H,24,25) |
| InChIKey | FADSFUVVGDLVFJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|