C14H19N3 — CID 67443317
1-N,1-N'-bis(prop-2-enyl)-3-pyridin-2-ylprop-1-ene-1,1-diamine (PubChem CID 67443317) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-N,1-N'-bis(prop-2-enyl)-3-pyridin-2-ylprop-1-ene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(prop-2-enyl)-3-pyridin-2-ylprop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 67443317 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-N,1-N'-bis(prop-2-enyl)-3-pyridin-2-ylprop-1-ene-1,1-diamine |
| SMILES | C=CCNC(=CCc1ccccn1)NCC=C |
| InChI | InChI=1S/C14H19N3/c1-3-10-16-14(17-11-4-2)9-8-13-7-5-6-12-15-13/h3-7,9,12,16-17H,1-2,8,10-11H2 |
| InChIKey | PYCSWUSEYZCNIB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|